C39H40N10O6 — CID 58098535
[3-[[3-[[7-[3-[(3-isocyanatophenyl)carbamoyl-methylamino]propylcarbamoylamino]-9H-fluoren-2-yl]carbamoylamino]propyl-methylcarbamoyl]amino]phenyl] cyanate (PubChem CID 58098535) has the molecular formula C39H40N10O6 and a molecular weight of 744.81 g/mol. Its IUPAC name is [3-[[3-[[7-[3-[(3-isocyanatophenyl)carbamoyl-methylamino]propylcarbamoylamino]-9H-fluoren-2-yl]carbamoylamino]propyl-methylcarbamoyl]amino]phenyl] cyanate.
| Compound Name | [3-[[3-[[7-[3-[(3-isocyanatophenyl)carbamoyl-methylamino]propylcarbamoylamino]-9H-fluoren-2-yl]carbamoylamino]propyl-methylcarbamoyl]amino]phenyl] cyanate |
|---|---|
| PubChem CID | 58098535 |
| Molecular Formula | C39H40N10O6 |
| Molecular Weight | 744.81 g/mol |
| Exact Mass | 744.31 |
| IUPAC Name | [3-[[3-[[7-[3-[(3-isocyanatophenyl)carbamoyl-methylamino]propylcarbamoylamino]-9H-fluoren-2-yl]carbamoylamino]propyl-methylcarbamoyl]amino]phenyl] cyanate |
| SMILES | CN(CCCNC(=O)Nc1ccc2c(c1)Cc1cc(NC(=O)NCCCN(C)C(=O)Nc3cccc(OC#N)c3)ccc1-2)C(=O)Nc1cccc(N=C=O)c1 |
| InChI | InChI=1S/C39H40N10O6/c1-48(38(53)46-29-8-3-7-28(22-29)43-25-50)17-5-15-41-36(51)44-31-11-13-34-26(20-31)19-27-21-32(12-14-35(27)34)45-37(52)42-16-6-18-49(2)39(54)47-30-9-4-10-33(23-30)55-24-40/h3-4,7-14,20-23H,5-6,15-19H2,1-2H3,(H,46,53)(H,47,54)(H2,41,44,51)(H2,42,45,52) |
| InChIKey | KRHLMVBCIYAPLW-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 209.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.81 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|