C5H8Br2N2 — CID 58099652
4,5-dibromo-1,2-dimethyl-4,5-dihydroimidazole (PubChem CID 58099652) has the molecular formula C5H8Br2N2 and a molecular weight of 255.94 g/mol. Its IUPAC name is 4,5-dibromo-1,2-dimethyl-4,5-dihydroimidazole.
| Compound Name | 4,5-dibromo-1,2-dimethyl-4,5-dihydroimidazole |
|---|---|
| PubChem CID | 58099652 |
| Molecular Formula | C5H8Br2N2 |
| Molecular Weight | 255.94 g/mol |
| Exact Mass | 253.91 |
| IUPAC Name | 4,5-dibromo-1,2-dimethyl-4,5-dihydroimidazole |
| SMILES | CC1=NC(Br)C(Br)N1C |
| InChI | InChI=1S/C5H8Br2N2/c1-3-8-4(6)5(7)9(3)2/h4-5H,1-2H3 |
| InChIKey | XRUJLCOMQDHTGI-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.94 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|