C25H21N2S+ — CID 58113552
5-(2,4,6-trimethylphenyl)-13-thia-5-aza-8-azoniapentacyclo[10.7.0.03,10.04,8.014,19]nonadeca-1(12),2,4(8),6,10,14,16,18-octaene (PubChem CID 58113552) has the molecular formula C25H21N2S+ and a molecular weight of 381.52 g/mol. Its IUPAC name is 5-(2,4,6-trimethylphenyl)-13-thia-5-aza-8-azoniapentacyclo[10.7.0.03,10.04,8.014,19]nonadeca-1(12),2,4(8),6,10,14,16,18-octaene.
| Compound Name | 5-(2,4,6-trimethylphenyl)-13-thia-5-aza-8-azoniapentacyclo[10.7.0.03,10.04,8.014,19]nonadeca-1(12),2,4(8),6,10,14,16,18-octaene |
|---|---|
| PubChem CID | 58113552 |
| Molecular Formula | C25H21N2S+ |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 5-(2,4,6-trimethylphenyl)-13-thia-5-aza-8-azoniapentacyclo[10.7.0.03,10.04,8.014,19]nonadeca-1(12),2,4(8),6,10,14,16,18-octaene |
| SMILES | Cc1cc(C)c(-n2cc[n+]3c2-c2cc4c(cc2C3)sc2ccccc24)c(C)c1 |
| InChI | InChI=1S/C25H21N2S/c1-15-10-16(2)24(17(3)11-15)27-9-8-26-14-18-12-23-21(13-20(18)25(26)27)19-6-4-5-7-22(19)28-23/h4-13H,14H2,1-3H3/q+1 |
| InChIKey | LFOFMDISPZOEAY-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|