C17H22N4O2S — CID 58115045
12-(1-ethylsulfonyl-4-methylpiperidin-3-yl)-1,5,7-triazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene (PubChem CID 58115045) has the molecular formula C17H22N4O2S and a molecular weight of 346.46 g/mol. Its IUPAC name is 12-(1-ethylsulfonyl-4-methylpiperidin-3-yl)-1,5,7-triazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene.
| Compound Name | 12-(1-ethylsulfonyl-4-methylpiperidin-3-yl)-1,5,7-triazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
|---|---|
| PubChem CID | 58115045 |
| Molecular Formula | C17H22N4O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 12-(1-ethylsulfonyl-4-methylpiperidin-3-yl)-1,5,7-triazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
| SMILES | CCS(=O)(=O)N1CCC(C)C(c2ccc3cnc4[nH]ccc4n23)C1 |
| InChI | InChI=1S/C17H22N4O2S/c1-3-24(22,23)20-9-7-12(2)14(11-20)15-5-4-13-10-19-17-16(21(13)15)6-8-18-17/h4-6,8,10,12,14,18H,3,7,9,11H2,1-2H3 |
| InChIKey | CYRYNKUNGYPCBG-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |