C18H20F3NO3 — CID 58124047
methyl (1R,9R,13S)-1,13-dimethyl-10-(2,2,2-trifluoroacetyl)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carboxylate (PubChem CID 58124047) has the molecular formula C18H20F3NO3 and a molecular weight of 355.36 g/mol. Its IUPAC name is methyl (1R,9R,13S)-1,13-dimethyl-10-(2,2,2-trifluoroacetyl)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carboxylate.
| Compound Name | methyl (1R,9R,13S)-1,13-dimethyl-10-(2,2,2-trifluoroacetyl)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carboxylate |
|---|---|
| PubChem CID | 58124047 |
| Molecular Formula | C18H20F3NO3 |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | methyl (1R,9R,13S)-1,13-dimethyl-10-(2,2,2-trifluoroacetyl)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)[C@]1(C)CCN(C(=O)C(F)(F)F)[C@H](C2)[C@H]1C |
| InChI | InChI=1S/C18H20F3NO3/c1-10-14-9-11-4-5-12(15(23)25-3)8-13(11)17(10,2)6-7-22(14)16(24)18(19,20)21/h4-5,8,10,14H,6-7,9H2,1-3H3/t10-,14-,17-/m1/s1 |
| InChIKey | HPGZFPTULHSWTR-LGFNAOKASA-N |
| XLogP | 3.09 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |