C16H17BrF3NO2 — CID 126493687
1-[(1R,9R)-5-bromo-4-hydroxy-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-10-yl]-2,2,2-trifluoroethanone (PubChem CID 126493687) has the molecular formula C16H17BrF3NO2 and a molecular weight of 392.22 g/mol. Its IUPAC name is 1-[(1R,9R)-5-bromo-4-hydroxy-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-10-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[(1R,9R)-5-bromo-4-hydroxy-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-10-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 126493687 |
| Molecular Formula | C16H17BrF3NO2 |
| Molecular Weight | 392.22 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | 1-[(1R,9R)-5-bromo-4-hydroxy-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-10-yl]-2,2,2-trifluoroethanone |
| SMILES | CC1[C@H]2Cc3cc(Br)c(O)cc3[C@]1(C)CCN2C(=O)C(F)(F)F |
| InChI | InChI=1S/C16H17BrF3NO2/c1-8-12-6-9-5-11(17)13(22)7-10(9)15(8,2)3-4-21(12)14(23)16(18,19)20/h5,7-8,12,22H,3-4,6H2,1-2H3/t8?,12-,15-/m1/s1 |
| InChIKey | DUKHTEQOZKBSSA-ZBWHEPRRSA-N |
| XLogP | 3.77 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.22 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |