C22H31NO3S — CID 58125644
2-[4-(tert-butylsulfonylmethyl)cyclohexyl]-5-(3-methoxyphenyl)-3H-pyrrole (PubChem CID 58125644) has the molecular formula C22H31NO3S and a molecular weight of 389.56 g/mol. Its IUPAC name is 2-[4-(tert-butylsulfonylmethyl)cyclohexyl]-5-(3-methoxyphenyl)-3H-pyrrole.
| Compound Name | 2-[4-(tert-butylsulfonylmethyl)cyclohexyl]-5-(3-methoxyphenyl)-3H-pyrrole |
|---|---|
| PubChem CID | 58125644 |
| Molecular Formula | C22H31NO3S |
| Molecular Weight | 389.56 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 2-[4-(tert-butylsulfonylmethyl)cyclohexyl]-5-(3-methoxyphenyl)-3H-pyrrole |
| SMILES | COc1cccc(C2=CCC(C3CCC(CS(=O)(=O)C(C)(C)C)CC3)=N2)c1 |
| InChI | InChI=1S/C22H31NO3S/c1-22(2,3)27(24,25)15-16-8-10-17(11-9-16)20-12-13-21(23-20)18-6-5-7-19(14-18)26-4/h5-7,13-14,16-17H,8-12,15H2,1-4H3 |
| InChIKey | PHVJPOMEQUQOAG-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.56 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |