C22H29N5O3 — CID 58129921
4-amino-2-butoxy-7-[[4-(morpholin-4-ylmethyl)phenyl]methyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 58129921) has the molecular formula C22H29N5O3 and a molecular weight of 411.51 g/mol. Its IUPAC name is 4-amino-2-butoxy-7-[[4-(morpholin-4-ylmethyl)phenyl]methyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 4-amino-2-butoxy-7-[[4-(morpholin-4-ylmethyl)phenyl]methyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 58129921 |
| Molecular Formula | C22H29N5O3 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | 4-amino-2-butoxy-7-[[4-(morpholin-4-ylmethyl)phenyl]methyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | CCCCOc1nc(N)c2c(n1)N(Cc1ccc(CN3CCOCC3)cc1)C(=O)C2 |
| InChI | InChI=1S/C22H29N5O3/c1-2-3-10-30-22-24-20(23)18-13-19(28)27(21(18)25-22)15-17-6-4-16(5-7-17)14-26-8-11-29-12-9-26/h4-7H,2-3,8-15H2,1H3,(H2,23,24,25) |
| InChIKey | LJVVRYHXAGDDNS-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|