About N-methoxy-N-methyl-3-nitro-5-(pentafluoro-λ6-sulfanyl)benzamide
N-methoxy-N-methyl-3-nitro-5-(pentafluoro-λ6-sulfanyl)benzamide (PubChem CID 58136777) has the molecular formula C9H9F5N2O4S
and a molecular weight of 336.24 g/mol. Its IUPAC name is N-methoxy-N-methyl-3-nitro-5-(pentafluoro-λ6-sulfanyl)benzamide.
Molecular Properties
| Compound Name | N-methoxy-N-methyl-3-nitro-5-(pentafluoro-λ6-sulfanyl)benzamide |
| PubChem CID | 58136777 |
| Molecular Formula | C9H9F5N2O4S |
| Molecular Weight | 336.24 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | N-methoxy-N-methyl-3-nitro-5-(pentafluoro-λ6-sulfanyl)benzamide |
| SMILES | CON(C)C(=O)c1cc([N+](=O)[O-])cc(S(F)(F)(F)(F)F)c1 |
| InChI | InChI=1S/C9H9F5N2O4S/c1-15(20-2)9(17)6-3-7(16(18)19)5-8(4-6)21(10,11,12,13)14/h3-5H,1-2H3 |
| InChIKey | QZBWQVXBRYIFCC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.24 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methoxy-N-methyl-3-nitro-5-(pentafluoro-λ6-sulfanyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methoxy-N-methyl-3-nitro-5-(pentafluoro-λ6-sulfanyl)benzamide?
The IUPAC name of N-methoxy-N-methyl-3-nitro-5-(pentafluoro-λ6-sulfanyl)benzamide (CID 58136777) is N-methoxy-N-methyl-3-nitro-5-(pentafluoro-λ6-sulfanyl)benzamide.
What is the SMILES notation for N-methoxy-N-methyl-3-nitro-5-(pentafluoro-λ6-sulfanyl)benzamide?
The canonical SMILES for N-methoxy-N-methyl-3-nitro-5-(pentafluoro-λ6-sulfanyl)benzamide is CON(C)C(=O)c1cc([N+](=O)[O-])cc(S(F)(F)(F)(F)F)c1.
What is the InChIKey of N-methoxy-N-methyl-3-nitro-5-(pentafluoro-λ6-sulfanyl)benzamide?
The InChIKey is QZBWQVXBRYIFCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F5N2O4S/c1-15(20-2)9(17)6-3-7(16(18)19)5-8(4-6)21(10,11,12,13)14/h3-5H,1-2H3.
What are the key properties of N-methoxy-N-methyl-3-nitro-5-(pentafluoro-λ6-sulfanyl)benzamide?
N-methoxy-N-methyl-3-nitro-5-(pentafluoro-λ6-sulfanyl)benzamide has a molecular weight of 336.24 g/mol, XLogP of 3.89, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methoxy-N-methyl-3-nitro-5-(pentafluoro-λ6-sulfanyl)benzamide is sourced from PubChem (CID 58136777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).