C27H28F3NO5S — CID 58143760
5-[2-oxo-2-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethyl]-2-[4-(trifluoromethyl)phenyl]isoindole-1,3-dione (PubChem CID 58143760) has the molecular formula C27H28F3NO5S and a molecular weight of 535.58 g/mol. Its IUPAC name is 5-[2-oxo-2-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethyl]-2-[4-(trifluoromethyl)phenyl]isoindole-1,3-dione.
| Compound Name | 5-[2-oxo-2-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethyl]-2-[4-(trifluoromethyl)phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 58143760 |
| Molecular Formula | C27H28F3NO5S |
| Molecular Weight | 535.58 g/mol |
| Exact Mass | 535.16 |
| IUPAC Name | 5-[2-oxo-2-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethyl]-2-[4-(trifluoromethyl)phenyl]isoindole-1,3-dione |
| SMILES | CC(C)S(=O)(=O)CC1CCC(C(=O)Cc2ccc3c(c2)C(=O)N(c2ccc(C(F)(F)F)cc2)C3=O)CC1 |
| InChI | InChI=1S/C27H28F3NO5S/c1-16(2)37(35,36)15-17-3-6-19(7-4-17)24(32)14-18-5-12-22-23(13-18)26(34)31(25(22)33)21-10-8-20(9-11-21)27(28,29)30/h5,8-13,16-17,19H,3-4,6-7,14-15H2,1-2H3 |
| InChIKey | HJUZUKURSWMQEG-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 88.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.58 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|