C28H24F3NO5S — CID 58144321
5-[2-[4-(tert-butylsulfonylmethyl)phenyl]-2-oxoethyl]-2-[4-(trifluoromethyl)phenyl]isoindole-1,3-dione (PubChem CID 58144321) has the molecular formula C28H24F3NO5S and a molecular weight of 543.56 g/mol. Its IUPAC name is 5-[2-[4-(tert-butylsulfonylmethyl)phenyl]-2-oxoethyl]-2-[4-(trifluoromethyl)phenyl]isoindole-1,3-dione.
| Compound Name | 5-[2-[4-(tert-butylsulfonylmethyl)phenyl]-2-oxoethyl]-2-[4-(trifluoromethyl)phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 58144321 |
| Molecular Formula | C28H24F3NO5S |
| Molecular Weight | 543.56 g/mol |
| Exact Mass | 543.13 |
| IUPAC Name | 5-[2-[4-(tert-butylsulfonylmethyl)phenyl]-2-oxoethyl]-2-[4-(trifluoromethyl)phenyl]isoindole-1,3-dione |
| SMILES | CC(C)(C)S(=O)(=O)Cc1ccc(C(=O)Cc2ccc3c(c2)C(=O)N(c2ccc(C(F)(F)F)cc2)C3=O)cc1 |
| InChI | InChI=1S/C28H24F3NO5S/c1-27(2,3)38(36,37)16-17-4-7-19(8-5-17)24(33)15-18-6-13-22-23(14-18)26(35)32(25(22)34)21-11-9-20(10-12-21)28(29,30)31/h4-14H,15-16H2,1-3H3 |
| InChIKey | FAXJVONNLVFPIO-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 88.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.56 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|