C26H28F3NO5S — CID 58144523
5-(7-tert-butylsulfonyl-2-oxoheptyl)-2-[4-(trifluoromethyl)phenyl]isoindole-1,3-dione (PubChem CID 58144523) has the molecular formula C26H28F3NO5S and a molecular weight of 523.57 g/mol. Its IUPAC name is 5-(7-tert-butylsulfonyl-2-oxoheptyl)-2-[4-(trifluoromethyl)phenyl]isoindole-1,3-dione.
| Compound Name | 5-(7-tert-butylsulfonyl-2-oxoheptyl)-2-[4-(trifluoromethyl)phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 58144523 |
| Molecular Formula | C26H28F3NO5S |
| Molecular Weight | 523.57 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | 5-(7-tert-butylsulfonyl-2-oxoheptyl)-2-[4-(trifluoromethyl)phenyl]isoindole-1,3-dione |
| SMILES | CC(C)(C)S(=O)(=O)CCCCCC(=O)Cc1ccc2c(c1)C(=O)N(c1ccc(C(F)(F)F)cc1)C2=O |
| InChI | InChI=1S/C26H28F3NO5S/c1-25(2,3)36(34,35)14-6-4-5-7-20(31)15-17-8-13-21-22(16-17)24(33)30(23(21)32)19-11-9-18(10-12-19)26(27,28)29/h8-13,16H,4-7,14-15H2,1-3H3 |
| InChIKey | WSCUXHWAJXXADG-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 88.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.57 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|