C43H58F13NO8 — CID 58150305
5-O-butyl 3-O-propyl 1-O-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) 1-(6-ethyl-2,2,3,6-tetramethyl-4-oxopiperidin-1-yl)oxy-7-phenyloctane-1,3,5-tricarboxylate (PubChem CID 58150305) has the molecular formula C43H58F13NO8 and a molecular weight of 963.91 g/mol. Its IUPAC name is 5-O-butyl 3-O-propyl 1-O-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) 1-(6-ethyl-2,2,3,6-tetramethyl-4-oxopiperidin-1-yl)oxy-7-phenyloctane-1,3,5-tricarboxylate.
| Compound Name | 5-O-butyl 3-O-propyl 1-O-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) 1-(6-ethyl-2,2,3,6-tetramethyl-4-oxopiperidin-1-yl)oxy-7-phenyloctane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 58150305 |
| Molecular Formula | C43H58F13NO8 |
| Molecular Weight | 963.91 g/mol |
| Exact Mass | 963.40 |
| IUPAC Name | 5-O-butyl 3-O-propyl 1-O-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) 1-(6-ethyl-2,2,3,6-tetramethyl-4-oxopiperidin-1-yl)oxy-7-phenyloctane-1,3,5-tricarboxylate |
| SMILES | CCCCOC(=O)C(CC(CC(ON1C(C)(CC)CC(=O)C(C)C1(C)C)C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)OCCC)CC(C)c1ccccc1 |
| InChI | InChI=1S/C43H58F13NO8/c1-9-12-20-63-33(59)29(22-26(4)28-16-14-13-15-17-28)23-30(34(60)62-19-10-2)24-32(65-57-36(6,7)27(5)31(58)25-37(57,8)11-3)35(61)64-21-18-38(44,45)39(46,47)40(48,49)41(50,51)42(52,53)43(54,55)56/h13-17,26-27,29-30,32H,9-12,18-25H2,1-8H3 |
| InChIKey | NCPOZQMZFHCKDQ-UHFFFAOYSA-N |
| XLogP | 11.32 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 963.91 |
| LogP ≤ 5 | 11.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|