C18H17N3O3S2 — CID 58157567
N-hydroxy-6-[5-(4-methoxyphenyl)-1,3-thiazol-2-yl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-2-carboxamide (PubChem CID 58157567) has the molecular formula C18H17N3O3S2 and a molecular weight of 387.49 g/mol. Its IUPAC name is N-hydroxy-6-[5-(4-methoxyphenyl)-1,3-thiazol-2-yl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-2-carboxamide.
| Compound Name | N-hydroxy-6-[5-(4-methoxyphenyl)-1,3-thiazol-2-yl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 58157567 |
| Molecular Formula | C18H17N3O3S2 |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | N-hydroxy-6-[5-(4-methoxyphenyl)-1,3-thiazol-2-yl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-2-carboxamide |
| SMILES | COc1ccc(-c2cnc(N3CCc4cc(C(=O)NO)sc4C3)s2)cc1 |
| InChI | InChI=1S/C18H17N3O3S2/c1-24-13-4-2-11(3-5-13)15-9-19-18(26-15)21-7-6-12-8-14(17(22)20-23)25-16(12)10-21/h2-5,8-9,23H,6-7,10H2,1H3,(H,20,22) |
| InChIKey | OYNVXLRCNCAVBO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|