C39H45FN3+ — CID 58160752
4-[[1-butyl-2-(4-fluorophenyl)indol-1-ium-3-ylidene]-[4-(diethylamino)phenyl]methyl]-N,N-diethylaniline (PubChem CID 58160752) has the molecular formula C39H45FN3+ and a molecular weight of 574.81 g/mol. Its IUPAC name is 4-[[1-butyl-2-(4-fluorophenyl)indol-1-ium-3-ylidene]-[4-(diethylamino)phenyl]methyl]-N,N-diethylaniline.
| Compound Name | 4-[[1-butyl-2-(4-fluorophenyl)indol-1-ium-3-ylidene]-[4-(diethylamino)phenyl]methyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 58160752 |
| Molecular Formula | C39H45FN3+ |
| Molecular Weight | 574.81 g/mol |
| Exact Mass | 574.36 |
| IUPAC Name | 4-[[1-butyl-2-(4-fluorophenyl)indol-1-ium-3-ylidene]-[4-(diethylamino)phenyl]methyl]-N,N-diethylaniline |
| SMILES | CCCC[N+]1=C(c2ccc(F)cc2)C(=C(c2ccc(N(CC)CC)cc2)c2ccc(N(CC)CC)cc2)c2ccccc21 |
| InChI | InChI=1S/C39H45FN3/c1-6-11-28-43-36-15-13-12-14-35(36)38(39(43)31-16-22-32(40)23-17-31)37(29-18-24-33(25-19-29)41(7-2)8-3)30-20-26-34(27-21-30)42(9-4)10-5/h12-27H,6-11,28H2,1-5H3/q+1 |
| InChIKey | NKRCUELKTTUPSC-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 9.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.81 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|