C25H32O7 — CID 58165659
[2-[[3-(2,2-dimethylbutanoyloxy)-1-adamantyl]oxy]-2-oxoethyl] 3-hydroxybenzoate (PubChem CID 58165659) has the molecular formula C25H32O7 and a molecular weight of 444.52 g/mol. Its IUPAC name is [2-[[3-(2,2-dimethylbutanoyloxy)-1-adamantyl]oxy]-2-oxoethyl] 3-hydroxybenzoate.
| Compound Name | [2-[[3-(2,2-dimethylbutanoyloxy)-1-adamantyl]oxy]-2-oxoethyl] 3-hydroxybenzoate |
|---|---|
| PubChem CID | 58165659 |
| Molecular Formula | C25H32O7 |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | [2-[[3-(2,2-dimethylbutanoyloxy)-1-adamantyl]oxy]-2-oxoethyl] 3-hydroxybenzoate |
| SMILES | CCC(C)(C)C(=O)OC12CC3CC(CC(OC(=O)COC(=O)c4cccc(O)c4)(C3)C1)C2 |
| InChI | InChI=1S/C25H32O7/c1-4-23(2,3)22(29)32-25-12-16-8-17(13-25)11-24(10-16,15-25)31-20(27)14-30-21(28)18-6-5-7-19(26)9-18/h5-7,9,16-17,26H,4,8,10-15H2,1-3H3 |
| InChIKey | ZJNQETJILWRHIY-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|