C18H20N+ — CID 58165782
14,15,15-trimethyl-13-azoniatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,8,13-hexaene (PubChem CID 58165782) has the molecular formula C18H20N+ and a molecular weight of 250.37 g/mol. Its IUPAC name is 14,15,15-trimethyl-13-azoniatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,8,13-hexaene.
| Compound Name | 14,15,15-trimethyl-13-azoniatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,8,13-hexaene |
|---|---|
| PubChem CID | 58165782 |
| Molecular Formula | C18H20N+ |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 14,15,15-trimethyl-13-azoniatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,8,13-hexaene |
| SMILES | CC1=[N+]2CCCc3cc4ccccc4c(c32)C1(C)C |
| InChI | InChI=1S/C18H20N/c1-12-18(2,3)16-15-9-5-4-7-13(15)11-14-8-6-10-19(12)17(14)16/h4-5,7,9,11H,6,8,10H2,1-3H3/q+1 |
| InChIKey | UBRAOAYXDQGQEP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|