C23H29N5O4S — CID 58172108
3-(3-aminopropyl)-5-[[4-[5-(dimethylamino)pentanoyl]-1,3-thiazol-2-yl]carbamoyl]-1H-indole-2-carboxylic acid (PubChem CID 58172108) has the molecular formula C23H29N5O4S and a molecular weight of 471.58 g/mol. Its IUPAC name is 3-(3-aminopropyl)-5-[[4-[5-(dimethylamino)pentanoyl]-1,3-thiazol-2-yl]carbamoyl]-1H-indole-2-carboxylic acid.
| Compound Name | 3-(3-aminopropyl)-5-[[4-[5-(dimethylamino)pentanoyl]-1,3-thiazol-2-yl]carbamoyl]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 58172108 |
| Molecular Formula | C23H29N5O4S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | 3-(3-aminopropyl)-5-[[4-[5-(dimethylamino)pentanoyl]-1,3-thiazol-2-yl]carbamoyl]-1H-indole-2-carboxylic acid |
| SMILES | CN(C)CCCCC(=O)c1csc(NC(=O)c2ccc3[nH]c(C(=O)O)c(CCCN)c3c2)n1 |
| InChI | InChI=1S/C23H29N5O4S/c1-28(2)11-4-3-7-19(29)18-13-33-23(26-18)27-21(30)14-8-9-17-16(12-14)15(6-5-10-24)20(25-17)22(31)32/h8-9,12-13,25H,3-7,10-11,24H2,1-2H3,(H,31,32)(H,26,27,30) |
| InChIKey | OCIYUDSCWQEKFE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 141.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|