C24H29N7O5S — CID 58768520
ethyl N-[[6-[[4-[2-(dimethylamino)ethylcarbamoyl]-1,3-thiazol-2-yl]carbamoyl]-1-oxo-2,3,4,9-tetrahydropyrido[3,4-b]indol-3-yl]methyl]carbamate (PubChem CID 58768520) has the molecular formula C24H29N7O5S and a molecular weight of 527.61 g/mol. Its IUPAC name is ethyl N-[[6-[[4-[2-(dimethylamino)ethylcarbamoyl]-1,3-thiazol-2-yl]carbamoyl]-1-oxo-2,3,4,9-tetrahydropyrido[3,4-b]indol-3-yl]methyl]carbamate.
| Compound Name | ethyl N-[[6-[[4-[2-(dimethylamino)ethylcarbamoyl]-1,3-thiazol-2-yl]carbamoyl]-1-oxo-2,3,4,9-tetrahydropyrido[3,4-b]indol-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 58768520 |
| Molecular Formula | C24H29N7O5S |
| Molecular Weight | 527.61 g/mol |
| Exact Mass | 527.20 |
| IUPAC Name | ethyl N-[[6-[[4-[2-(dimethylamino)ethylcarbamoyl]-1,3-thiazol-2-yl]carbamoyl]-1-oxo-2,3,4,9-tetrahydropyrido[3,4-b]indol-3-yl]methyl]carbamate |
| SMILES | CCOC(=O)NCC1Cc2c([nH]c3ccc(C(=O)Nc4nc(C(=O)NCCN(C)C)cs4)cc23)C(=O)N1 |
| InChI | InChI=1S/C24H29N7O5S/c1-4-36-24(35)26-11-14-10-16-15-9-13(5-6-17(15)28-19(16)22(34)27-14)20(32)30-23-29-18(12-37-23)21(33)25-7-8-31(2)3/h5-6,9,12,14,28H,4,7-8,10-11H2,1-3H3,(H,25,33)(H,26,35)(H,27,34)(H,29,30,32) |
| InChIKey | HJHAOZLWFWVMHV-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 157.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.61 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|