C23H30NO3SiY- — CID 58176191
3-(3-methoxyphenyl)-N-[(2R)-3-oxo-1-trimethylsilylhexan-2-yl]benzamide;yttrium (PubChem CID 58176191) has the molecular formula C23H30NO3SiY- and a molecular weight of 485.49 g/mol. Its IUPAC name is 3-(3-methoxyphenyl)-N-[(2R)-3-oxo-1-trimethylsilylhexan-2-yl]benzamide;yttrium.
| Compound Name | 3-(3-methoxyphenyl)-N-[(2R)-3-oxo-1-trimethylsilylhexan-2-yl]benzamide;yttrium |
|---|---|
| PubChem CID | 58176191 |
| Molecular Formula | C23H30NO3SiY- |
| Molecular Weight | 485.49 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | 3-(3-methoxyphenyl)-N-[(2R)-3-oxo-1-trimethylsilylhexan-2-yl]benzamide;yttrium |
| SMILES | C[CH-]CC(=O)[C@H](C[Si](C)(C)C)NC(=O)c1cccc(-c2cccc(OC)c2)c1.[Y] |
| InChI | InChI=1S/C23H30NO3Si.Y/c1-6-9-22(25)21(16-28(3,4)5)24-23(26)19-12-7-10-17(14-19)18-11-8-13-20(15-18)27-2;/h6-8,10-15,21H,9,16H2,1-5H3,(H,24,26);/q-1;/t21-;/m0./s1 |
| InChIKey | UWVMJXGPBJPPGV-BOXHHOBZSA-N |
| XLogP | 4.98 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.49 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|