C25H29N3O4Si — CID 90765019
methyl 3-[3-[[(2R)-1-[(1-cyanocyclopropyl)amino]-1-oxo-3-trimethylsilylpropan-2-yl]carbamoyl]phenyl]benzoate (PubChem CID 90765019) has the molecular formula C25H29N3O4Si and a molecular weight of 463.61 g/mol. Its IUPAC name is methyl 3-[3-[[(2R)-1-[(1-cyanocyclopropyl)amino]-1-oxo-3-trimethylsilylpropan-2-yl]carbamoyl]phenyl]benzoate.
| Compound Name | methyl 3-[3-[[(2R)-1-[(1-cyanocyclopropyl)amino]-1-oxo-3-trimethylsilylpropan-2-yl]carbamoyl]phenyl]benzoate |
|---|---|
| PubChem CID | 90765019 |
| Molecular Formula | C25H29N3O4Si |
| Molecular Weight | 463.61 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | methyl 3-[3-[[(2R)-1-[(1-cyanocyclopropyl)amino]-1-oxo-3-trimethylsilylpropan-2-yl]carbamoyl]phenyl]benzoate |
| SMILES | COC(=O)c1cccc(-c2cccc(C(=O)N[C@@H](C[Si](C)(C)C)C(=O)NC3(C#N)CC3)c2)c1 |
| InChI | InChI=1S/C25H29N3O4Si/c1-32-24(31)20-10-6-8-18(14-20)17-7-5-9-19(13-17)22(29)27-21(15-33(2,3)4)23(30)28-25(16-26)11-12-25/h5-10,13-14,21H,11-12,15H2,1-4H3,(H,27,29)(H,28,30)/t21-/m0/s1 |
| InChIKey | ABSQIGXLQPLJAK-NRFANRHFSA-N |
| XLogP | 3.75 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.61 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|