C48H46N4O6 — CID 58177724
3',3',5',8-tetramethyl-6-nitro-1'-[[4-[(3',3',5',8-tetramethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)methyl]phenyl]methyl]spiro[chromene-2,2'-indole] (PubChem CID 58177724) has the molecular formula C48H46N4O6 and a molecular weight of 774.92 g/mol. Its IUPAC name is 3',3',5',8-tetramethyl-6-nitro-1'-[[4-[(3',3',5',8-tetramethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)methyl]phenyl]methyl]spiro[chromene-2,2'-indole].
| Compound Name | 3',3',5',8-tetramethyl-6-nitro-1'-[[4-[(3',3',5',8-tetramethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)methyl]phenyl]methyl]spiro[chromene-2,2'-indole] |
|---|---|
| PubChem CID | 58177724 |
| Molecular Formula | C48H46N4O6 |
| Molecular Weight | 774.92 g/mol |
| Exact Mass | 774.34 |
| IUPAC Name | 3',3',5',8-tetramethyl-6-nitro-1'-[[4-[(3',3',5',8-tetramethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)methyl]phenyl]methyl]spiro[chromene-2,2'-indole] |
| SMILES | Cc1ccc2c(c1)C(C)(C)C1(C=Cc3cc([N+](=O)[O-])cc(C)c3O1)N2Cc1ccc(CN2c3ccc(C)cc3C(C)(C)C23C=Cc2cc([N+](=O)[O-])cc(C)c2O3)cc1 |
| InChI | InChI=1S/C48H46N4O6/c1-29-9-15-41-39(21-29)45(5,6)47(19-17-35-25-37(51(53)54)23-31(3)43(35)57-47)49(41)27-33-11-13-34(14-12-33)28-50-42-16-10-30(2)22-40(42)46(7,8)48(50)20-18-36-26-38(52(55)56)24-32(4)44(36)58-48/h9-26H,27-28H2,1-8H3 |
| InChIKey | CQFNQWMRGQXZID-UHFFFAOYSA-N |
| XLogP | 10.94 |
| TPSA | 111.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.92 |
| LogP ≤ 5 | 10.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|