C23H19FN2O3 — CID 139243713
9-fluoro-6,10b-dimethyl-2-nitro-5a-phenyl-11H-chromeno[2,3-b]indole (PubChem CID 139243713) has the molecular formula C23H19FN2O3 and a molecular weight of 390.41 g/mol. Its IUPAC name is 9-fluoro-6,10b-dimethyl-2-nitro-5a-phenyl-11H-chromeno[2,3-b]indole.
| Compound Name | 9-fluoro-6,10b-dimethyl-2-nitro-5a-phenyl-11H-chromeno[2,3-b]indole |
|---|---|
| PubChem CID | 139243713 |
| Molecular Formula | C23H19FN2O3 |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 9-fluoro-6,10b-dimethyl-2-nitro-5a-phenyl-11H-chromeno[2,3-b]indole |
| SMILES | CN1c2ccc(F)cc2C2(C)Cc3cc([N+](=O)[O-])ccc3OC12c1ccccc1 |
| InChI | InChI=1S/C23H19FN2O3/c1-22-14-15-12-18(26(27)28)9-11-21(15)29-23(22,16-6-4-3-5-7-16)25(2)20-10-8-17(24)13-19(20)22/h3-13H,14H2,1-2H3 |
| InChIKey | HWLHZPXIXJQQIQ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|