C18H16N2O3S — CID 58178243
5-[3-(7-methyl-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]-2-methylsulfanylaniline (PubChem CID 58178243) has the molecular formula C18H16N2O3S and a molecular weight of 340.40 g/mol. Its IUPAC name is 5-[3-(7-methyl-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]-2-methylsulfanylaniline.
| Compound Name | 5-[3-(7-methyl-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]-2-methylsulfanylaniline |
|---|---|
| PubChem CID | 58178243 |
| Molecular Formula | C18H16N2O3S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 5-[3-(7-methyl-1,3-benzodioxol-5-yl)-1,2-oxazol-4-yl]-2-methylsulfanylaniline |
| SMILES | CSc1ccc(-c2conc2-c2cc(C)c3c(c2)OCO3)cc1N |
| InChI | InChI=1S/C18H16N2O3S/c1-10-5-12(7-15-18(10)22-9-21-15)17-13(8-23-20-17)11-3-4-16(24-2)14(19)6-11/h3-8H,9,19H2,1-2H3 |
| InChIKey | QXDRWSPLYOFSAO-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|