C16H24N2OS — CID 58178704
(4-tert-butylphenyl)-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-methylidene-oxo-λ6-sulfane (PubChem CID 58178704) has the molecular formula C16H24N2OS and a molecular weight of 292.45 g/mol. Its IUPAC name is (4-tert-butylphenyl)-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-methylidene-oxo-λ6-sulfane.
| Compound Name | (4-tert-butylphenyl)-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-methylidene-oxo-λ6-sulfane |
|---|---|
| PubChem CID | 58178704 |
| Molecular Formula | C16H24N2OS |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | (4-tert-butylphenyl)-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-methylidene-oxo-λ6-sulfane |
| SMILES | C=S(=O)(c1ccc(C(C)(C)C)cc1)N1C[C@@H]2C[C@H]1CN2 |
| InChI | InChI=1S/C16H24N2OS/c1-16(2,3)12-5-7-15(8-6-12)20(4,19)18-11-13-9-14(18)10-17-13/h5-8,13-14,17H,4,9-11H2,1-3H3/t13-,14-,20?/m0/s1 |
| InChIKey | FNLPECAXZGRDFW-JWDIZXQDSA-N |
| XLogP | 2.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|