C27H29F6NO2 — CID 581849
3-[3,6-bis(trifluoromethyl)phenanthren-9-yl]-N,N-dibutyl-3-hydroxypropanamide (PubChem CID 581849) has the molecular formula C27H29F6NO2 and a molecular weight of 513.52 g/mol. Its IUPAC name is 3-[3,6-bis(trifluoromethyl)phenanthren-9-yl]-N,N-dibutyl-3-hydroxypropanamide.
| Compound Name | 3-[3,6-bis(trifluoromethyl)phenanthren-9-yl]-N,N-dibutyl-3-hydroxypropanamide |
|---|---|
| PubChem CID | 581849 |
| Molecular Formula | C27H29F6NO2 |
| Molecular Weight | 513.52 g/mol |
| Exact Mass | 513.21 |
| IUPAC Name | 3-[3,6-bis(trifluoromethyl)phenanthren-9-yl]-N,N-dibutyl-3-hydroxypropanamide |
| SMILES | CCCCN(CCCC)C(=O)CC(O)c1cc2ccc(C(F)(F)F)cc2c2cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C27H29F6NO2/c1-3-5-11-34(12-6-4-2)25(36)16-24(35)23-13-17-7-8-18(26(28,29)30)14-21(17)22-15-19(27(31,32)33)9-10-20(22)23/h7-10,13-15,24,35H,3-6,11-12,16H2,1-2H3 |
| InChIKey | BIVAATUREMCDQX-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.52 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|