C16H20N2O5 — CID 58186291
(4-isocyano-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) 4-(2-methylprop-2-enoylamino)butanoate (PubChem CID 58186291) has the molecular formula C16H20N2O5 and a molecular weight of 320.35 g/mol. Its IUPAC name is (4-isocyano-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) 4-(2-methylprop-2-enoylamino)butanoate.
| Compound Name | (4-isocyano-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) 4-(2-methylprop-2-enoylamino)butanoate |
|---|---|
| PubChem CID | 58186291 |
| Molecular Formula | C16H20N2O5 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | (4-isocyano-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl) 4-(2-methylprop-2-enoylamino)butanoate |
| SMILES | [C-]#[N+]C1(OC(=O)CCCNC(=O)C(=C)C)CCC2CC1OC2=O |
| InChI | InChI=1S/C16H20N2O5/c1-10(2)14(20)18-8-4-5-13(19)23-16(17-3)7-6-11-9-12(16)22-15(11)21/h11-12H,1,4-9H2,2H3,(H,18,20) |
| InChIKey | LRZAQYQFJBJORX-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 86.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|