C6H9O3+ — CID 58186662
(3R,3aS,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-5-ylium-3-ol (PubChem CID 58186662) has the molecular formula C6H9O3+ and a molecular weight of 129.14 g/mol. Its IUPAC name is (3R,3aS,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-5-ylium-3-ol.
| Compound Name | (3R,3aS,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-5-ylium-3-ol |
|---|---|
| PubChem CID | 58186662 |
| Molecular Formula | C6H9O3+ |
| Molecular Weight | 129.14 g/mol |
| Exact Mass | 129.05 |
| IUPAC Name | (3R,3aS,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-5-ylium-3-ol |
| SMILES | O[C@H]1CO[C@H]2O[CH+]C[C@H]21 |
| InChI | InChI=1S/C6H9O3/c7-5-3-9-6-4(5)1-2-8-6/h2,4-7H,1,3H2/q+1/t4-,5-,6+/m0/s1 |
| InChIKey | FMLUDYPWZPQGAP-HCWXCVPCSA-N |
| XLogP | -0.10 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.14 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|