C14H15NO4 — CID 58187718
4-(cyclopentylmethyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione (PubChem CID 58187718) has the molecular formula C14H15NO4 and a molecular weight of 261.28 g/mol. Its IUPAC name is 4-(cyclopentylmethyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione.
| Compound Name | 4-(cyclopentylmethyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione |
|---|---|
| PubChem CID | 58187718 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 4-(cyclopentylmethyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione |
| SMILES | O=C1Cc2oc(=O)cc(CC3CCCC3)c2C(=O)N1 |
| InChI | InChI=1S/C14H15NO4/c16-11-7-10-13(14(18)15-11)9(6-12(17)19-10)5-8-3-1-2-4-8/h6,8H,1-5,7H2,(H,15,16,18) |
| InChIKey | ICOJAWNZYSQFBF-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|