C14H13F2NO4 — CID 58317062
4-[[(1S)-3,3-difluorocyclopentyl]methyl]-8H-pyrano[3,2-c]pyridine-2,5,7-trione (PubChem CID 58317062) has the molecular formula C14H13F2NO4 and a molecular weight of 297.26 g/mol. Its IUPAC name is 4-[[(1S)-3,3-difluorocyclopentyl]methyl]-8H-pyrano[3,2-c]pyridine-2,5,7-trione.
| Compound Name | 4-[[(1S)-3,3-difluorocyclopentyl]methyl]-8H-pyrano[3,2-c]pyridine-2,5,7-trione |
|---|---|
| PubChem CID | 58317062 |
| Molecular Formula | C14H13F2NO4 |
| Molecular Weight | 297.26 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 4-[[(1S)-3,3-difluorocyclopentyl]methyl]-8H-pyrano[3,2-c]pyridine-2,5,7-trione |
| SMILES | O=C1Cc2oc(=O)cc(C[C@@H]3CCC(F)(F)C3)c2C(=O)N1 |
| InChI | InChI=1S/C14H13F2NO4/c15-14(16)2-1-7(6-14)3-8-4-11(19)21-9-5-10(18)17-13(20)12(8)9/h4,7H,1-3,5-6H2,(H,17,18,20)/t7-/m0/s1 |
| InChIKey | RSUOOLRNDXQACO-ZETCQYMHSA-N |
| XLogP | 1.43 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.26 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|