C8H12F6O5S2 — CID 58195708
1,1-bis(trifluoromethylsulfonyl)hexan-3-ol (PubChem CID 58195708) has the molecular formula C8H12F6O5S2 and a molecular weight of 366.30 g/mol. Its IUPAC name is 1,1-bis(trifluoromethylsulfonyl)hexan-3-ol.
| Compound Name | 1,1-bis(trifluoromethylsulfonyl)hexan-3-ol |
|---|---|
| PubChem CID | 58195708 |
| Molecular Formula | C8H12F6O5S2 |
| Molecular Weight | 366.30 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | 1,1-bis(trifluoromethylsulfonyl)hexan-3-ol |
| SMILES | CCCC(O)CC(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C8H12F6O5S2/c1-2-3-5(15)4-6(20(16,17)7(9,10)11)21(18,19)8(12,13)14/h5-6,15H,2-4H2,1H3 |
| InChIKey | DZRIRMCBDYVBQW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.30 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |