C22H24O7S — CID 58210469
[(2R,4aR,7S,8R,8aS)-4a-ethenyl-7-hydroxy-2-phenyl-6,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-8-yl] 4-methylbenzenesulfonate (PubChem CID 58210469) has the molecular formula C22H24O7S and a molecular weight of 432.49 g/mol. Its IUPAC name is [(2R,4aR,7S,8R,8aS)-4a-ethenyl-7-hydroxy-2-phenyl-6,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-8-yl] 4-methylbenzenesulfonate.
| Compound Name | [(2R,4aR,7S,8R,8aS)-4a-ethenyl-7-hydroxy-2-phenyl-6,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-8-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 58210469 |
| Molecular Formula | C22H24O7S |
| Molecular Weight | 432.49 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | [(2R,4aR,7S,8R,8aS)-4a-ethenyl-7-hydroxy-2-phenyl-6,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-8-yl] 4-methylbenzenesulfonate |
| SMILES | C=C[C@@]12CO[C@@H](c3ccccc3)O[C@H]1[C@H](OS(=O)(=O)c1ccc(C)cc1)[C@@H](O)CO2 |
| InChI | InChI=1S/C22H24O7S/c1-3-22-14-26-21(16-7-5-4-6-8-16)28-20(22)19(18(23)13-27-22)29-30(24,25)17-11-9-15(2)10-12-17/h3-12,18-21,23H,1,13-14H2,2H3/t18-,19+,20-,21+,22+/m0/s1 |
| InChIKey | LNNCDHPWUWXKFV-MLBCHFTJSA-N |
| XLogP | 2.50 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.49 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|