C22H26O7S — CID 11812109
(4aR,6S,8S,8aR)-6-methoxy-8-[(4-methylphenyl)sulfonylmethyl]-2-phenyl-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-8-ol (PubChem CID 11812109) has the molecular formula C22H26O7S and a molecular weight of 434.51 g/mol. Its IUPAC name is (4aR,6S,8S,8aR)-6-methoxy-8-[(4-methylphenyl)sulfonylmethyl]-2-phenyl-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-8-ol.
| Compound Name | (4aR,6S,8S,8aR)-6-methoxy-8-[(4-methylphenyl)sulfonylmethyl]-2-phenyl-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-8-ol |
|---|---|
| PubChem CID | 11812109 |
| Molecular Formula | C22H26O7S |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | (4aR,6S,8S,8aR)-6-methoxy-8-[(4-methylphenyl)sulfonylmethyl]-2-phenyl-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-8-ol |
| SMILES | CO[C@@H]1C[C@@](O)(CS(=O)(=O)c2ccc(C)cc2)[C@@H]2OC(c3ccccc3)OC[C@H]2O1 |
| InChI | InChI=1S/C22H26O7S/c1-15-8-10-17(11-9-15)30(24,25)14-22(23)12-19(26-2)28-18-13-27-21(29-20(18)22)16-6-4-3-5-7-16/h3-11,18-21,23H,12-14H2,1-2H3/t18-,19+,20-,21?,22-/m1/s1 |
| InChIKey | RCUQMDQRBIOCFG-XQXKBUOWSA-N |
| XLogP | 2.38 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |