C23H28O6S2 — CID 89038043
[(6S,8R,8aR)-6-ethylsulfanyl-7-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 4-methylbenzenesulfonate (PubChem CID 89038043) has the molecular formula C23H28O6S2 and a molecular weight of 464.61 g/mol. Its IUPAC name is [(6S,8R,8aR)-6-ethylsulfanyl-7-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 4-methylbenzenesulfonate.
| Compound Name | [(6S,8R,8aR)-6-ethylsulfanyl-7-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 89038043 |
| Molecular Formula | C23H28O6S2 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | [(6S,8R,8aR)-6-ethylsulfanyl-7-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 4-methylbenzenesulfonate |
| SMILES | CCS[C@@H]1OC2COC(c3ccccc3)O[C@H]2[C@H](OS(=O)(=O)c2ccc(C)cc2)C1C |
| InChI | InChI=1S/C23H28O6S2/c1-4-30-23-16(3)20(29-31(24,25)18-12-10-15(2)11-13-18)21-19(27-23)14-26-22(28-21)17-8-6-5-7-9-17/h5-13,16,19-23H,4,14H2,1-3H3/t16?,19?,20-,21-,22?,23+/m1/s1 |
| InChIKey | XVVLZKXKMVHVDT-MVKMCQSPSA-N |
| XLogP | 4.30 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|