C15H24N5O14P3S2 — CID 58214240
[[(2R,5R)-5-[2-amino-1-[4-(methyldisulfanyl)butanoyl]-6-oxopurin-9-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 58214240) has the molecular formula C15H24N5O14P3S2 and a molecular weight of 655.43 g/mol. Its IUPAC name is [[(2R,5R)-5-[2-amino-1-[4-(methyldisulfanyl)butanoyl]-6-oxopurin-9-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,5R)-5-[2-amino-1-[4-(methyldisulfanyl)butanoyl]-6-oxopurin-9-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 58214240 |
| Molecular Formula | C15H24N5O14P3S2 |
| Molecular Weight | 655.43 g/mol |
| Exact Mass | 655.00 |
| IUPAC Name | [[(2R,5R)-5-[2-amino-1-[4-(methyldisulfanyl)butanoyl]-6-oxopurin-9-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CSSCCCC(=O)n1c(N)nc2c(ncn2[C@H]2CC(O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)c1=O |
| InChI | InChI=1S/C15H24N5O14P3S2/c1-38-39-4-2-3-10(22)20-14(23)12-13(18-15(20)16)19(7-17-12)11-5-8(21)9(32-11)6-31-36(27,28)34-37(29,30)33-35(24,25)26/h7-9,11,21H,2-6H2,1H3,(H2,16,18)(H,27,28)(H,29,30)(H2,24,25,26)/t8?,9-,11-/m1/s1 |
| InChIKey | ZXUZRZJWQTZOGQ-HOGWDWRMSA-N |
| XLogP | 0.60 |
| TPSA | 285.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.43 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|