C18H24N2O5 — CID 58219015
N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-5-methyl-4-oxo-5-phenylfuran-2-carboxamide (PubChem CID 58219015) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-5-methyl-4-oxo-5-phenylfuran-2-carboxamide.
| Compound Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-5-methyl-4-oxo-5-phenylfuran-2-carboxamide |
|---|---|
| PubChem CID | 58219015 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-5-methyl-4-oxo-5-phenylfuran-2-carboxamide |
| SMILES | CC1(c2ccccc2)OC(C(=O)NCCOCCOCCN)=CC1=O |
| InChI | InChI=1S/C18H24N2O5/c1-18(14-5-3-2-4-6-14)16(21)13-15(25-18)17(22)20-8-10-24-12-11-23-9-7-19/h2-6,13H,7-12,19H2,1H3,(H,20,22) |
| InChIKey | RAOFCKHMQDROBB-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|