C11H19NO6 — CID 58226223
[3-oxo-3-[(tritiooxycarbonylamino)methoxy]propyl] 2,2-dimethylbutanoate (PubChem CID 58226223) has the molecular formula C11H19NO6 and a molecular weight of 263.28 g/mol. Its IUPAC name is [3-oxo-3-[(tritiooxycarbonylamino)methoxy]propyl] 2,2-dimethylbutanoate.
| Compound Name | [3-oxo-3-[(tritiooxycarbonylamino)methoxy]propyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 58226223 |
| Molecular Formula | C11H19NO6 |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | [3-oxo-3-[(tritiooxycarbonylamino)methoxy]propyl] 2,2-dimethylbutanoate |
| SMILES | [3H]OC(=O)NCOC(=O)CCOC(=O)C(C)(C)CC |
| InChI | InChI=1S/C11H19NO6/c1-4-11(2,3)9(14)17-6-5-8(13)18-7-12-10(15)16/h12H,4-7H2,1-3H3,(H,15,16)/i/hT |
| InChIKey | DTJZUDOJAFXSOR-MNYXATJNSA-N |
| XLogP | 1.12 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|