C19H22N2O6S — CID 58228580
(2R,4S,4aS,5S)-2,4-dimethyl-8-methylsulfonylspiro[2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline-5,3'-piperidine]-2',4',6'-trione (PubChem CID 58228580) has the molecular formula C19H22N2O6S and a molecular weight of 406.46 g/mol. Its IUPAC name is (2R,4S,4aS,5S)-2,4-dimethyl-8-methylsulfonylspiro[2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline-5,3'-piperidine]-2',4',6'-trione.
| Compound Name | (2R,4S,4aS,5S)-2,4-dimethyl-8-methylsulfonylspiro[2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline-5,3'-piperidine]-2',4',6'-trione |
|---|---|
| PubChem CID | 58228580 |
| Molecular Formula | C19H22N2O6S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | (2R,4S,4aS,5S)-2,4-dimethyl-8-methylsulfonylspiro[2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline-5,3'-piperidine]-2',4',6'-trione |
| SMILES | C[C@@H]1CN2c3ccc(S(C)(=O)=O)cc3C[C@@]3(C(=O)CC(=O)NC3=O)[C@H]2[C@H](C)O1 |
| InChI | InChI=1S/C19H22N2O6S/c1-10-9-21-14-5-4-13(28(3,25)26)6-12(14)8-19(17(21)11(2)27-10)15(22)7-16(23)20-18(19)24/h4-6,10-11,17H,7-9H2,1-3H3,(H,20,23,24)/t10-,11+,17-,19-/m1/s1 |
| InChIKey | HHDGQBYWOHFQTF-BKSPZVJESA-N |
| XLogP | 0.23 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|