C18H19BrN2O4 — CID 58228610
(2R,4S,4aS,5S)-8-bromo-2,4-dimethylspiro[2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline-5,3'-piperidine]-2',4',6'-trione (PubChem CID 58228610) has the molecular formula C18H19BrN2O4 and a molecular weight of 407.26 g/mol. Its IUPAC name is (2R,4S,4aS,5S)-8-bromo-2,4-dimethylspiro[2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline-5,3'-piperidine]-2',4',6'-trione.
| Compound Name | (2R,4S,4aS,5S)-8-bromo-2,4-dimethylspiro[2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline-5,3'-piperidine]-2',4',6'-trione |
|---|---|
| PubChem CID | 58228610 |
| Molecular Formula | C18H19BrN2O4 |
| Molecular Weight | 407.26 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | (2R,4S,4aS,5S)-8-bromo-2,4-dimethylspiro[2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline-5,3'-piperidine]-2',4',6'-trione |
| SMILES | C[C@@H]1CN2c3ccc(Br)cc3C[C@@]3(C(=O)CC(=O)NC3=O)[C@H]2[C@H](C)O1 |
| InChI | InChI=1S/C18H19BrN2O4/c1-9-8-21-13-4-3-12(19)5-11(13)7-18(16(21)10(2)25-9)14(22)6-15(23)20-17(18)24/h3-5,9-10,16H,6-8H2,1-2H3,(H,20,23,24)/t9-,10+,16-,18-/m1/s1 |
| InChIKey | RTIIMHZUPVZBLN-PIHOGDGFSA-N |
| XLogP | 1.59 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.26 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|