C22H24N4O5 — CID 58228584
(2R,4S,4aS,5S)-8-(5-ethyl-1,2,4-oxadiazol-3-yl)-2,4-dimethylspiro[2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline-5,3'-piperidine]-2',4',6'-trione (PubChem CID 58228584) has the molecular formula C22H24N4O5 and a molecular weight of 424.46 g/mol. Its IUPAC name is (2R,4S,4aS,5S)-8-(5-ethyl-1,2,4-oxadiazol-3-yl)-2,4-dimethylspiro[2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline-5,3'-piperidine]-2',4',6'-trione.
| Compound Name | (2R,4S,4aS,5S)-8-(5-ethyl-1,2,4-oxadiazol-3-yl)-2,4-dimethylspiro[2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline-5,3'-piperidine]-2',4',6'-trione |
|---|---|
| PubChem CID | 58228584 |
| Molecular Formula | C22H24N4O5 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | (2R,4S,4aS,5S)-8-(5-ethyl-1,2,4-oxadiazol-3-yl)-2,4-dimethylspiro[2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline-5,3'-piperidine]-2',4',6'-trione |
| SMILES | CCc1nc(-c2ccc3c(c2)C[C@@]2(C(=O)CC(=O)NC2=O)[C@H]2[C@H](C)O[C@H](C)CN32)no1 |
| InChI | InChI=1S/C22H24N4O5/c1-4-18-24-20(25-31-18)13-5-6-15-14(7-13)9-22(16(27)8-17(28)23-21(22)29)19-12(3)30-11(2)10-26(15)19/h5-7,11-12,19H,4,8-10H2,1-3H3,(H,23,28,29)/t11-,12+,19-,22-/m1/s1 |
| InChIKey | JNVRJNQWTRVPGE-LHAYYZPNSA-N |
| XLogP | 1.44 |
| TPSA | 114.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|