C15H9IrN2- — CID 58239345
17-aza-3-azanidatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7,9,11,14,16-octaene;iridium (PubChem CID 58239345) has the molecular formula C15H9IrN2- and a molecular weight of 409.47 g/mol. Its IUPAC name is 17-aza-3-azanidatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7,9,11,14,16-octaene;iridium.
| Compound Name | 17-aza-3-azanidatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7,9,11,14,16-octaene;iridium |
|---|---|
| PubChem CID | 58239345 |
| Molecular Formula | C15H9IrN2- |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | 17-aza-3-azanidatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7,9,11,14,16-octaene;iridium |
| SMILES | [Ir].c1ccc2c(c1)c1cccnc1c1[n-]ccc21 |
| InChI | InChI=1S/C15H9N2.Ir/c1-2-5-11-10(4-1)12-6-3-8-16-14(12)15-13(11)7-9-17-15;/h1-9H;/q-1; |
| InChIKey | UBPDBODYBBTUEK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 26.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|