C13H7IrN4- — CID 58239349
iridium;3,4,8-triaza-5-azanidatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),3,7(12),8,10,13,15-octaene (PubChem CID 58239349) has the molecular formula C13H7IrN4- and a molecular weight of 411.44 g/mol. Its IUPAC name is iridium;3,4,8-triaza-5-azanidatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),3,7(12),8,10,13,15-octaene.
| Compound Name | iridium;3,4,8-triaza-5-azanidatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),3,7(12),8,10,13,15-octaene |
|---|---|
| PubChem CID | 58239349 |
| Molecular Formula | C13H7IrN4- |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 412.03 |
| IUPAC Name | iridium;3,4,8-triaza-5-azanidatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),3,7(12),8,10,13,15-octaene |
| SMILES | [Ir].c1ccc2c(c1)c1cccnc1c1[n-]nnc21 |
| InChI | InChI=1S/C13H7N4.Ir/c1-2-5-10-8(4-1)9-6-3-7-14-11(9)13-12(10)15-17-16-13;/h1-7H;/q-1; |
| InChIKey | ORNIHGJMRYJPPV-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 52.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|