C9H17FO — CID 58241366
(4S,5R)-2-fluoro-3,4,5,6-tetramethyloxane (PubChem CID 58241366) has the molecular formula C9H17FO and a molecular weight of 160.23 g/mol. Its IUPAC name is (4S,5R)-2-fluoro-3,4,5,6-tetramethyloxane.
| Compound Name | (4S,5R)-2-fluoro-3,4,5,6-tetramethyloxane |
|---|---|
| PubChem CID | 58241366 |
| Molecular Formula | C9H17FO |
| Molecular Weight | 160.23 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | (4S,5R)-2-fluoro-3,4,5,6-tetramethyloxane |
| SMILES | CC1C(F)OC(C)[C@H](C)[C@@H]1C |
| InChI | InChI=1S/C9H17FO/c1-5-6(2)8(4)11-9(10)7(5)3/h5-9H,1-4H3/t5-,6+,7?,8?,9?/m0/s1 |
| InChIKey | HBMVLTZWGQLDNN-YPKBUBAISA-N |
| XLogP | 2.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.23 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |