C12H10BrNO2S2 — CID 58248831
3-bromo-N-[2-(5-methylthiophen-2-yl)-2-oxoethyl]thiophene-2-carboxamide (PubChem CID 58248831) has the molecular formula C12H10BrNO2S2 and a molecular weight of 344.26 g/mol. Its IUPAC name is 3-bromo-N-[2-(5-methylthiophen-2-yl)-2-oxoethyl]thiophene-2-carboxamide.
| Compound Name | 3-bromo-N-[2-(5-methylthiophen-2-yl)-2-oxoethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 58248831 |
| Molecular Formula | C12H10BrNO2S2 |
| Molecular Weight | 344.26 g/mol |
| Exact Mass | 342.93 |
| IUPAC Name | 3-bromo-N-[2-(5-methylthiophen-2-yl)-2-oxoethyl]thiophene-2-carboxamide |
| SMILES | Cc1ccc(C(=O)CNC(=O)c2sccc2Br)s1 |
| InChI | InChI=1S/C12H10BrNO2S2/c1-7-2-3-10(18-7)9(15)6-14-12(16)11-8(13)4-5-17-11/h2-5H,6H2,1H3,(H,14,16) |
| InChIKey | MZNKXDFMUTTWFV-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.26 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |