C13H14N2O2S2 — CID 47028537
1-[2-(5-methylthiophen-2-yl)-2-oxoethyl]-3-(thiophen-2-ylmethyl)urea (PubChem CID 47028537) has the molecular formula C13H14N2O2S2 and a molecular weight of 294.40 g/mol. Its IUPAC name is 1-[2-(5-methylthiophen-2-yl)-2-oxoethyl]-3-(thiophen-2-ylmethyl)urea.
| Compound Name | 1-[2-(5-methylthiophen-2-yl)-2-oxoethyl]-3-(thiophen-2-ylmethyl)urea |
|---|---|
| PubChem CID | 47028537 |
| Molecular Formula | C13H14N2O2S2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 1-[2-(5-methylthiophen-2-yl)-2-oxoethyl]-3-(thiophen-2-ylmethyl)urea |
| SMILES | Cc1ccc(C(=O)CNC(=O)NCc2cccs2)s1 |
| InChI | InChI=1S/C13H14N2O2S2/c1-9-4-5-12(19-9)11(16)8-15-13(17)14-7-10-3-2-6-18-10/h2-6H,7-8H2,1H3,(H2,14,15,17) |
| InChIKey | OPDLWQPZYOOQSK-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |