C15H28N+ — CID 58252612
1-methyl-1-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)pyrrolidin-1-ium (PubChem CID 58252612) has the molecular formula C15H28N+ and a molecular weight of 222.40 g/mol. Its IUPAC name is 1-methyl-1-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)pyrrolidin-1-ium.
| Compound Name | 1-methyl-1-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)pyrrolidin-1-ium |
|---|---|
| PubChem CID | 58252612 |
| Molecular Formula | C15H28N+ |
| Molecular Weight | 222.40 g/mol |
| Exact Mass | 222.22 |
| IUPAC Name | 1-methyl-1-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)pyrrolidin-1-ium |
| SMILES | CC1(C)C2CCC1(C)C([N+]1(C)CCCC1)C2 |
| InChI | InChI=1S/C15H28N/c1-14(2)12-7-8-15(14,3)13(11-12)16(4)9-5-6-10-16/h12-13H,5-11H2,1-4H3/q+1 |
| InChIKey | PQWQLCXJBZDHDB-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.40 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|