C48H70O5 — CID 58261276
[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 6-[4-[(3-ethyloxetan-3-yl)methoxy]butoxy]naphthalene-2-carboxylate (PubChem CID 58261276) has the molecular formula C48H70O5 and a molecular weight of 727.08 g/mol. Its IUPAC name is [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 6-[4-[(3-ethyloxetan-3-yl)methoxy]butoxy]naphthalene-2-carboxylate.
| Compound Name | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 6-[4-[(3-ethyloxetan-3-yl)methoxy]butoxy]naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 58261276 |
| Molecular Formula | C48H70O5 |
| Molecular Weight | 727.08 g/mol |
| Exact Mass | 726.52 |
| IUPAC Name | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 6-[4-[(3-ethyloxetan-3-yl)methoxy]butoxy]naphthalene-2-carboxylate |
| SMILES | CCC1(COCCCCOc2ccc3cc(C(=O)OC4CCC5(C)C(=CCC6C5CCC5(C)C(C(C)CCCC(C)C)CCC65)C4)ccc3c2)COC1 |
| InChI | InChI=1S/C48H70O5/c1-7-48(31-51-32-48)30-50-25-8-9-26-52-39-17-15-35-27-37(14-13-36(35)28-39)45(49)53-40-21-23-46(5)38(29-40)16-18-41-43-20-19-42(34(4)12-10-11-33(2)3)47(43,6)24-22-44(41)46/h13-17,27-28,33-34,40-44H,7-12,18-26,29-32H2,1-6H3 |
| InChIKey | PDTPCIULIJSJBQ-UHFFFAOYSA-N |
| XLogP | 12.01 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.08 |
| LogP ≤ 5 | 12.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|