C42H64O5 — CID 58261123
[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-[2-[(3-ethyloxetan-3-yl)methoxy]ethoxy]benzoate (PubChem CID 58261123) has the molecular formula C42H64O5 and a molecular weight of 648.97 g/mol. Its IUPAC name is [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-[2-[(3-ethyloxetan-3-yl)methoxy]ethoxy]benzoate.
| Compound Name | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-[2-[(3-ethyloxetan-3-yl)methoxy]ethoxy]benzoate |
|---|---|
| PubChem CID | 58261123 |
| Molecular Formula | C42H64O5 |
| Molecular Weight | 648.97 g/mol |
| Exact Mass | 648.48 |
| IUPAC Name | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-[2-[(3-ethyloxetan-3-yl)methoxy]ethoxy]benzoate |
| SMILES | CCC1(COCCOc2ccc(C(=O)OC3CCC4(C)C(=CCC5C4CCC4(C)C(C(C)CCCC(C)C)CCC54)C3)cc2)COC1 |
| InChI | InChI=1S/C42H64O5/c1-7-42(27-45-28-42)26-44-23-24-46-33-14-11-31(12-15-33)39(43)47-34-19-21-40(5)32(25-34)13-16-35-37-18-17-36(30(4)10-8-9-29(2)3)41(37,6)22-20-38(35)40/h11-15,29-30,34-38H,7-10,16-28H2,1-6H3 |
| InChIKey | BVLYACMPQZPGHA-UHFFFAOYSA-N |
| XLogP | 10.08 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.97 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|