C37H49N5O8 — CID 58262426
benzyl N-[(3R)-4-(hydroxyamino)-3-[[4-(4-methoxyphenyl)phenyl]methyl-[2-[2-(4-propanoylpiperazin-1-yl)ethoxy]ethoxy]amino]-4-oxobutyl]carbamate (PubChem CID 58262426) has the molecular formula C37H49N5O8 and a molecular weight of 691.83 g/mol. Its IUPAC name is benzyl N-[(3R)-4-(hydroxyamino)-3-[[4-(4-methoxyphenyl)phenyl]methyl-[2-[2-(4-propanoylpiperazin-1-yl)ethoxy]ethoxy]amino]-4-oxobutyl]carbamate.
| Compound Name | benzyl N-[(3R)-4-(hydroxyamino)-3-[[4-(4-methoxyphenyl)phenyl]methyl-[2-[2-(4-propanoylpiperazin-1-yl)ethoxy]ethoxy]amino]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 58262426 |
| Molecular Formula | C37H49N5O8 |
| Molecular Weight | 691.83 g/mol |
| Exact Mass | 691.36 |
| IUPAC Name | benzyl N-[(3R)-4-(hydroxyamino)-3-[[4-(4-methoxyphenyl)phenyl]methyl-[2-[2-(4-propanoylpiperazin-1-yl)ethoxy]ethoxy]amino]-4-oxobutyl]carbamate |
| SMILES | CCC(=O)N1CCN(CCOCCON(Cc2ccc(-c3ccc(OC)cc3)cc2)[C@H](CCNC(=O)OCc2ccccc2)C(=O)NO)CC1 |
| InChI | InChI=1S/C37H49N5O8/c1-3-35(43)41-21-19-40(20-22-41)23-24-48-25-26-50-42(27-29-9-11-31(12-10-29)32-13-15-33(47-2)16-14-32)34(36(44)39-46)17-18-38-37(45)49-28-30-7-5-4-6-8-30/h4-16,34,46H,3,17-28H2,1-2H3,(H,38,45)(H,39,44)/t34-/m1/s1 |
| InChIKey | SHUYLKBJHMOMTM-UUWRZZSWSA-N |
| XLogP | 3.86 |
| TPSA | 142.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.83 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|