C43H56N6O5 — CID 71084739
benzyl N-[5-[[6-butyl-2-(4-methoxyphenyl)quinoline-4-carbonyl]amino]-6-[3-(4-methylpiperazin-1-yl)propylamino]-6-oxohexyl]carbamate (PubChem CID 71084739) has the molecular formula C43H56N6O5 and a molecular weight of 736.96 g/mol. Its IUPAC name is benzyl N-[5-[[6-butyl-2-(4-methoxyphenyl)quinoline-4-carbonyl]amino]-6-[3-(4-methylpiperazin-1-yl)propylamino]-6-oxohexyl]carbamate.
| Compound Name | benzyl N-[5-[[6-butyl-2-(4-methoxyphenyl)quinoline-4-carbonyl]amino]-6-[3-(4-methylpiperazin-1-yl)propylamino]-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 71084739 |
| Molecular Formula | C43H56N6O5 |
| Molecular Weight | 736.96 g/mol |
| Exact Mass | 736.43 |
| IUPAC Name | benzyl N-[5-[[6-butyl-2-(4-methoxyphenyl)quinoline-4-carbonyl]amino]-6-[3-(4-methylpiperazin-1-yl)propylamino]-6-oxohexyl]carbamate |
| SMILES | CCCCc1ccc2nc(-c3ccc(OC)cc3)cc(C(=O)NC(CCCCNC(=O)OCc3ccccc3)C(=O)NCCCN3CCN(C)CC3)c2c1 |
| InChI | InChI=1S/C43H56N6O5/c1-4-5-12-32-16-21-38-36(29-32)37(30-40(46-38)34-17-19-35(53-3)20-18-34)41(50)47-39(42(51)44-23-11-24-49-27-25-48(2)26-28-49)15-9-10-22-45-43(52)54-31-33-13-7-6-8-14-33/h6-8,13-14,16-21,29-30,39H,4-5,9-12,15,22-28,31H2,1-3H3,(H,44,51)(H,45,52)(H,47,50) |
| InChIKey | HZDWLJBCJRXMEL-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 125.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.96 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|